Methyl 5-bromo-2-chloropyridine-3-carboxylate
Catalog No: FT-0648898
CAS No: 78686-79-0
- Chemical Name: Methyl 5-bromo-2-chloropyridine-3-carboxylate
- Molecular Formula: C7H5BrClNO2
- Molecular Weight: 250.48
- InChI Key: MOMQDEDQGJAKII-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5BrClNO2/c1-12-7(11)5-2-4(8)3-10-6(5)9/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 275.6±35.0 °C at 760 mmHg |
|---|---|
| CAS: | 78686-79-0 |
| MF: | C7H5BrClNO2 |
| Melting_Point: | 50-52ºC |
| Symbol: | Warning |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 250.477 |
| Product_Name: | Methyl 5-bromo-2-chloronicotinate |
| Flash_Point: | 120.5±25.9 °C |
| Exact_Mass: | 248.919205 |
|---|---|
| MF: | C7H5BrClNO2 |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 250.477 |
| Refractive_Index: | 1.569 |
| Bolling_Point: | 275.6±35.0 °C at 760 mmHg |
| PSA: | 39.19000 |
| LogP: | 2.12 |
| Flash_Point: | 120.5±25.9 °C |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Melting_Point: | 50-52ºC |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2933399090 |
| Safety_Statements: | H302 |
| Hazard_Codes: | Xi: Irritant; |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)